kbhale7856 kbhale7856

26-11-2022
Chemistry

Answered

CCC=C(C)CC
Spell out the full name of the compound.

Answer :

Other Questions

Which is the major organic product from the following reaction? [tex]\mathrm{CH}_3 \mathrm{CH}_2 \mathrm{COH} \frac{\text { 1. } \mathrm{Br}_2, \mathrm{PBr}_3}{

Identify the expected major product of the following reaction. [tex]\underset{\mathrm{H}_3 \mathrm{O}^{+}}{\longrightarrow}[/tex] ?CC(C)C(C)(O)COCC(O)C(C)(C)OCC

What is the relationship between the following two compounds?CCC(C)C(C)CC andCC(C)CC(C)C Constitutional isomers Identical Stereoisomers Not isomers, different c

What is the correct systematic name for the compound shown here?CC1CCCCC1O

Rank the following carbocations in order of decreasing stability. Most Stable Least StableCC1[C]CCCC1[C+]C1CCCCC1 [tex]{ }^{+} \mathrm{CH}_3[/tex]C[C+]1CCCCC1

Enter the IUPAC name of the ester depicted below.CCCOC(=O)C(C)CC

Predict the major product for the following reactionCC=C(C)C1CCCCC1 [tex]\underset{\mathrm{CH}_3 \mathrm{CH}_2 \mathrm{OH}}{\longrightarrow}[/tex]

Draw the organic product formed in the following reaction.C=C1CCCCC1 [1] [tex]0 \mathrm{sO}_4[/tex] [2] [tex]\mathrm{NaHSO}_3, \mathrm{H}_2 \mathrm{O}[/tex]

30. Identify the correet IUPAC name for the following structures.CCCC(C(C)F)C(C)CC A) 4-(2-iodo-1-methylethyl)-3-methylheptane B) 3-s-butyl-1-iodo-2-methylhexan

Select the reagent(s) required for the following transformation.Nc1ccccc1 [tex]\longrightarrow[/tex]Ic1ccccc1 a) [tex]\mathrm{Nal}[/tex] b) (1) [tex]\mathrm{NaN