hazle4507 hazle4507

26-11-2022
Chemistry

Answered

30. Identify the correet IUPAC name for the following structures.
CCCC(C(C)F)C(C)CC
A) 4-(2-iodo-1-methylethyl)-3-methylheptane
B) 3-s-butyl-1-iodo-2-methylhexane
C) 1 -iodo-2, 4-dimethyl-3-propylhexane
D) 2,4-dimethyl-1-iodo-3-propylhexane

Answer :

Other Questions

Enter the IUPAC name of the ester depicted below.CCCOC(=O)C(C)CC

Provide the major organic product of the reaction shown below.CCC(CC)=NO [tex]\longrightarrow \mathrm{H}_3 \mathrm{O}^{+}, \Delta[/tex]

How many [tex]\pi[/tex] bonds are there in one molecule of acrylonitrile ?C=CCC#N 2 1 5 3

What is the rmissing reagernt irn the reaction belove?O=C1CCCN1C1CCNC1 a) NaE:-14/CH:OH b) DIEAl [tex]-1-1[/tex] c) [tex]1-12, P[/tex] Pi-C [tex]^{-1}[/tex] d)

Draw the organic product formed in the following reaction.C=C1CCCCC1 [1] [tex]0 \mathrm{sO}_4[/tex] [2] [tex]\mathrm{NaHSO}_3, \mathrm{H}_2 \mathrm{O}[/tex]

Select the correct IUPAC name for the cycloalkane: The IUPAC name is: 1-chloro-I-iodocyclobutane 1,1-iodochlorocyclobutane chloroiodocyclobutane 1-jodo-]-chloro

Provide the major organic product of the following reaction.CC(=O)CCc1ccccc1 [tex]\frac{\text { 1. }\left(\mathrm{CH}_3 \mathrm{CH}_2\right)_2 \mathrm{NH} . \ma

Select the correct IUPAC name for the cycloalkane: The IUPAC name is: 1-chloro-I-iodocyclobutane 1,1-iodochlorocyclobutane chloroiodocyclobutane 1-jodo-]-chloro

Select the reagent(s) required for the following transformation.Nc1ccccc1 [tex]\longrightarrow[/tex]Ic1ccccc1 a) [tex]\mathrm{Nal}[/tex] b) (1) [tex]\mathrm{NaN

Select the correct proper or common name for the compound.CCC(CCC(=O)O)C(C)Cl The compound is named: 4-ethyl-5-chlorohexanoic acid 5-chloro-4-ethylhexanoic acid