28-10-2022
Chemistry

Answered

A reaction between liquid reactants occurs at 26.0-degree celsius in a sealed, evacuated vessel with a measured volume of 45.0L. Measurements show that the reaction produced 15g of chlorine pentafluoride gas. Calculate the pressure of chlorine pentafluoride gas in a reaction vessel after the reaction. You may ignore the volume of the liquid reactants—round your answer to 2 significant digits.

Answer :

Other Questions

What is the volume of H2 gas produced at stp from the reaction of 25.0 g of Al.

1. If an ideal gas initially at 1.00 bar and 1.30 L is compressed at constant temperature to a volume of 0.600 L, what is the final pressure of the compressed

Show work1. In a reaction between the elements aluminum and chlorine, aluminum chloride is produced. Write the balanced chemical equation.

The table shows the nature of reactants and products formed in a certain type of chemical reaction.Nature of Reactants and ProductsReactants ProductsMetal + Ion

During Chemistry Lab, the student must immerse a magnesium strip into 100 mL of 2 M hydrochloric acid at atmospheric pressure and 30ºC. Principally, the work is

5.0 grams of Ch4 gas is placed in a 500 mL flask at 25C. What pressure would this gas be exert?? 5.0 grams Ne and 5.0 grams Cl2 are mixed together in a 5.0 L fl

A 25L sample of gas contains 4 puffs of air. If 2 more puffs of air are added, what volume would be required to hold the sample of gas at the same temperature a

A student collects 25 mL of gas at 550 mmHg. What volume would this gas occupy at 760 mmHg? There is no change in temperature or mass.1) write down the name of

HMH Book- Ecology and the environment, pg.28 What does the equation tell you about the number of atoms of each kind in the reactants and products

CH3CH2CH2CO2H(l)+CH2CH3OH(l)H+⟶CH3CH2CH2CO2CH2CH3(l)+H2O(l) A chemist ran the reaction and obtained 5.75 g of ethyl butyrate. What was the percent yield?