d2hernandez d2hernandez

28-10-2022
Chemistry

Answered

CH3CH2CH2CO2H(l)+CH2CH3OH(l)H+⟶CH3CH2CH2CO2CH2CH3(l)+H2O(l) A chemist ran the reaction and obtained 5.75 g of ethyl butyrate. What was the percent yield?

Answer :

Other Questions

Please help… Ammonia is obtained from H2(g) and N2(g). 50 g of each reactant is mixed. nz + Н2 NHg a) Find the limiting reactant b) Excess reactant c) Th

The table shows the nature of reactants and products formed in a certain type of chemical reaction.Nature of Reactants and ProductsReactants ProductsMetal + Ion

FOR THE CHEMICAL EQUATION NaHCO3 + CH3COOH -> NaOOCCH3 + H2O + CO2- were any new elements introduced into the closed system ? Where did the gas come from?- a

What is the volume of H2 gas produced at stp from the reaction of 25.0 g of Al.

What is the balanced equation for the reaction: sodium phosphate Na3PO4 reacts with copper (II) chloride CuCl2 to yield copper (II) phosphate Cu3(PO4)2 and sodi

During Chemistry Lab, the student must immerse a magnesium strip into 100 mL of 2 M hydrochloric acid at atmospheric pressure and 30ºC. Principally, the work is

the following data were obtained in an experiment to find the molecular mass of a liquid: volume of gas: 8.352 mL Temperature: 99 C Pressure: 742 mmHg Mass of

Show work1. In a reaction between the elements aluminum and chlorine, aluminum chloride is produced. Write the balanced chemical equation.

After testing an aqueous solution of ammonia, a company found that the percent by weight of the ammonia was 8% If it were possible, how much water would need to

How many moles of C7H16 (heptane) must be reacted according to the following balanced chemical reaction to transfer -474.9 kJ of heat?