InAllActuality1254 InAllActuality1254

27-11-2022
Chemistry

Answered

what is the missing reagent in the reaction below
CC(=O)c1ccccc1
C=C(c1ccccc1)N(C)C

Answer :

Other Questions

2) Provide a systematic name for each of the following compounds below:CCCCC(CC)C(C)C(C)CCCCCC(CC)C(C)CCC(C)C(C(C)C)C(C)C

rank the following carbocations in order of decreasing stability.C[C+](C)c1ccccc1CC1[C+]CCCC1[CH2]C1CCCCC1

Which one of the following is the strongest acid? How did you get your answer?CCCC(=O)OCCC(C)C(=O)OCCC(=O)OCCC(Cl)C(=O)OCCC(Br)C(=O)O a. 1 b. 2 c. 3 d. 4 e. 5

Name the aldehyde displayed below.CCC(Br)CCCCC=O

Select the correct proper or common name for the compound.CC(Cl)CC(=O)O The compound is named: 3-chloro-3-methylpropanoate ion 3-chloro-3-methylpropanoate 3-chl

Identify the type of reaction given: NaReO4 + N(C4H9)4CI (N(C4H9)4[ReO4] + NaCl O double displacement reaction O combination reaction O combustion reaction O si

hat is the expected major product for the following reaction? Please provide the reagent(s) needed to facilitate the following transformation. Oh HO_ NH2

Questions Find the missing mass Reactant:2AI(OH)3 Product:3H₂O+Al₂O3 9.7g 21.8g Answers

Study this chemical reaction: [tex] 2 \mathrm{Fe}+3 \mathrm{I}_2 \rightarrow 2 \mathrm{Fel}_3 [/tex] Then, write balanced half-reactions describing the oxidatio