bbbbbbbhdhdhdh4781 bbbbbbbhdhdhdh4781

26-11-2022
Chemistry

Answered

Tetracyanoethylene has the skeleton shown below:
NCC(CN)C(CN)CN
From its Lewis structure determine the following:
How many sigma and pi bonds are in the molecule?
9 sigma and 8 pi
4 sigma and [tex]5 \mathrm{pi}[/tex]
9 sigma and 9 pi
5 sigma and [tex]8 \mathrm{pi}[/tex]
6 sigma and 8 pi

Answer :

Other Questions

Draw the organic product formed in the following reaction.C=C1CCCCC1 [1] [tex]0 \mathrm{sO}_4[/tex] [2] [tex]\mathrm{NaHSO}_3, \mathrm{H}_2 \mathrm{O}[/tex]

Select the reagent(s) required for the following transformation.Nc1ccccc1 [tex]\longrightarrow[/tex]Ic1ccccc1 a) [tex]\mathrm{Nal}[/tex] b) (1) [tex]\mathrm{NaN

3)CC(=O)Cl 1) [tex]\mathrm{Mg}[/tex] 2) [tex]\mathrm{CO}_2[/tex] 3) [tex]\mathrm{H}_3 \mathrm{O}^{+}[/tex] 4) [tex]\mathrm{NaOH}[/tex] 5) [tex]\mathrm{EtI}[/tex

How many atoms are in [tex]15.6[/tex] grams of silicon? [tex]0.555[/tex] [tex]3.34 \times 10^{23}[/tex] [tex]2.64 \times 10^{26}[/tex] 438

1) How are hydrogens removed from polyprotic acids? a. How does this relate to the [tex]\mathrm{K}_{\mathrm{a}}[/tex] of these same species? b. What is the rela

[tex]\begin{tabular}{|c|c|c|} \hline ionic compound & cation & anion \\ \hline [tex]\mathrm{NaCl}[/tex] & [tex]\mathrm{Na}^{+}[/tex] & [tex]\mat

Rank the following carbocations in order of decreasing stability. Most Stable Least StableCC1[C]CCCC1[C+]C1CCCCC1 [tex]{ }^{+} \mathrm{CH}_3[/tex]C[C+]1CCCCC1

Which element has the following electron configuration: [tex] 1 s^2 2 s^2 2 p^6 3 s^2 3 p^6 \quad 4 s^2 \quad 3 d^{10} 4 p^3 [/tex] a. [tex]\mathrm{Pb}[/tex] b.

Which is the major organic product from the following reaction? [tex]\mathrm{CH}_3 \mathrm{CH}_2 \mathrm{COH} \frac{\text { 1. } \mathrm{Br}_2, \mathrm{PBr}_3}{

The structure of [tex]\mathrm{TeF}_5[/tex] is (check your book to see figure) Draw a complete Lewis structure for [tex]\mathrm{TeF}_5[/tex], and explain the dis