diamondmorreasc3970 diamondmorreasc3970

25-11-2022
Chemistry

Answered

Below are two incorrect IUPAC names. What are the correct IUPAC names?
2-methyl-3-propylpentane
Correct name: 3-ethyl-2-methylhexane
3-(1,1-dimethylethyl)pentane
Correct name:

Answer :

Other Questions

Enter the IUPAC narne of the ester depicted below.CCCOC(=O)C(C)CC

Draw the Newman projection of the most stable and least stable conformers of 3-ethyl-2-methyl-pentane viewed through the C2—C3 bond (i.e., C-2 in the front, C-3

Select the correct proper or common name for the compound.CCC(CCC(=O)O)C(C)Cl The compound is named: 4-ethyl-5-chlorohexanoic acid 5-chloro-4-ethylhexanoic acid

given that the nucleophilic substitution reaction used 5.0 ml of t-pentyl alcohol and 12.0 ml of conc. hydrochloric acid to produce t-pentyl chloride, what is t

1s22s22p63s23p64s23d2 is the correct electron configuration for which of the following atoms? Ca Ti Ge Zr

Tetracyanoethylene has the skeleton shown below:NCC(CN)C(CN)CN From its I.evis structure determine the following: How many sigma and pi bonds are in the molecul

Provide a systematic name of the following compound below:CCC(C)CC(C)C(C)CC

Give formulas corresponding to the following names: (a) Potassium tris(oxalato)chromate(III) (b) Tris(ethylenediamine) cobalt(III) pentacyanoiodomanganate(II) (

The molecular scenes below depict the reaction Y⟹2Z at four different times, out of sequence, as it reaches equilibrium. Each sphere (Y is red and Z is green) r

Part B Next, you'll test your hypothesis from part A by examining the reaction times in water at four different temperatures. You'll carry out the reaction usin