Amarianac4682 Amarianac4682

24-11-2022
Chemistry

Answered

when balancing redox equations, you need to balance the charge. what would you use to balance the charge if the equation were being balanced in acid? h h2 o oh- none of these

Answer :

Other Questions

Predict the major product for the following reaction 1) (CF3COzhHg, CH3CHzOH 2) NaBHa OH OH OH

Draw the best Lewis structure for [tex]\mathrm{CCl}_3^{-1}[/tex]. What is the formal charge on the C?

Part B In a separate location, take notes from the sources you've identified. While takin websites, use these reading strategies. In the space provided, describ

Name the following Acid: [tex]\mathrm{HBO}_3[/tex] if [tex]\left(\mathrm{BO}_3\right)^{-3}[/tex] is called the borate ion. borous acid hydrogen borate boric aci

In part D of task 1, you identified at least two ways in which the reaction of nitro be changed to alter the equilibrium. Use the simulation to test those chang

We can draw three inequivalent Lewis structures for carbonyl sulfide, SCO. The concepts of formal charge and electronegativity can help us choose the structure

Select the correct proper or common name for the compound.CCC(CCC(=O)O)C(C)Cl The compound is named: 4-ethyl-5-chlorohexanoic acid 5-chloro-4-ethylhexanoic acid

A hydrocarbon has a molecular ion peak at a mass-to- charge ratio of 84 (relative abundance of 62.0%) and an [M + 1] peak with a relative abundance of 4.1%. How

Consider the reaction of an alkyl bromide and hydroxide ion. ~OH Draw the SN | product:

Part E Study the trend of the graph from part C. What would the reaction time be (in seconds) if th cooled to 5°C?