adrixnguyen7603 adrixnguyen7603

24-11-2022
Chemistry

Answered

a 47.2-ml sample of naoh is titrated with 0.624 m hbr. 27.4 ml of the acid are required to reach the equivalence point. what is the molarity of the base? multiple choice question.

Answer :

Other Questions

The half-life of raon-22 is 3.8 days. How much of a 100 gram sample is left after 15.2 days

Name the following Acid: [tex]\mathrm{HBO}_3[/tex] if [tex]\left(\mathrm{BO}_3\right)^{-3}[/tex] is called the borate ion. borous acid hydrogen borate boric aci

Select the correct proper or common name for the compound.CCC(CCC(=O)O)C(C)Cl The compound is named: 4-ethyl-5-chlorohexanoic acid 5-chloro-4-ethylhexanoic acid

The molecular formula of Acetic Acid is HC2H3Oz: What is the empirical formula? CHO CHzO HC2H3O2 HCH3O'

molecules at the surface of a liquid, if they possess enough kinetic energy, can escape to the gas state. as a result, a liquid will exert a vapor pressure. if

What is the Lewis structure for H2CS, with the central atom of C. Is the molecular polar or nonpolar? Identify the intermolecular forces present?

Sequence Determination of the Brain Peptide Leucine Enkephalin A group of peptides that influence nerve transmission in certain parts of the brain have been iso

Atomic Emission Spectra When a sample of gas is excited by applying a large alternating electric field, the gas emits light at certain discrete wavelengths. The

In part D of task 1, you identified at least two ways in which the reaction of nitro be changed to alter the equilibrium. Use the simulation to test those chang

Draw the best Lewis dot structure for BrCl4-. What is the geometry of the structure, (draw or name)?What types of bonds are between each atom? Is the molecule p