tgranahan2233 tgranahan2233

24-11-2022
Chemistry

Answered

if the volumes in the buret and the flask are identical and the concentration of the acid in the buret is 0.500 m, what is the concentration of the base in the flask?

Answer :

Other Questions

Part D Explain how the reaction rate compared to the concentration of the vinegar and bakin Revisit your hypothesis in part A, and explain how it compares with

Atomic Emission Spectra When a sample of gas is excited by applying a large alternating electric field, the gas emits light at certain discrete wavelengths. The

molecules at the surface of a liquid, if they possess enough kinetic energy, can escape to the gas state. as a result, a liquid will exert a vapor pressure. if

In part D of task 1, you identified at least two ways in which the reaction of nitro be changed to alter the equilibrium. Use the simulation to test those chang

Name the following Acid: [tex]\mathrm{HBO}_3[/tex] if [tex]\left(\mathrm{BO}_3\right)^{-3}[/tex] is called the borate ion. borous acid hydrogen borate boric aci

Nitrogen monoxide and oxygen react to form nitrogen diox- ide. Consider the mixture of NO and O2 shown in the accom- panying diagram. The blue spheres represent

or each of the following species: C2+ & O2- Write the molecular orbital energy diagram and fill in the electrons Hint: in each case, the number of valence e

The molecular formula of Acetic Acid is HC2H3Oz: What is the empirical formula? CHO CHzO HC2H3O2 HCH3O'

Draw the Lewis structure for SeOBr2 in the window below and then answer the questions that follow. Do not include overall ion charges or formal charges in your

Select the correct proper or common name for the compound.CCC(CCC(=O)O)C(C)Cl The compound is named: 4-ethyl-5-chlorohexanoic acid 5-chloro-4-ethylhexanoic acid