santosm7392 santosm7392

24-11-2022
Chemistry

Answered

Describe how to make pure dry crystals of magnesium chloride from magnesium carbonate and a dilute acid.

Answer :

Other Questions

Name the following Acid: [tex]\mathrm{HBO}_3[/tex] if [tex]\left(\mathrm{BO}_3\right)^{-3}[/tex] is called the borate ion. borous acid hydrogen borate boric aci

Select the correct proper or common name for the compound.CCC(CCC(=O)O)C(C)Cl The compound is named: 4-ethyl-5-chlorohexanoic acid 5-chloro-4-ethylhexanoic acid

Which of the following statements about CH3OH and CH2O are true? The molecules of CH3OH can form London forces, dipole/dipole forces, and hydrogen bonds. The CH

Metal sulfates are hygroscopic and will absorb water from the atmosphere. As a result, they must be kept in desiccators to keep them dry. Suppose, hypotheticall

Sequence Determination of the Brain Peptide Leucine Enkephalin A group of peptides that influence nerve transmission in certain parts of the brain have been iso

Part B In a separate location, take notes from the sources you've identified. While takin websites, use these reading strategies. In the space provided, describ

Part D Explain how the reaction rate compared to the concentration of the vinegar and bakin Revisit your hypothesis in part A, and explain how it compares with

Part B Next, you'll test your hypothesis from part A by examining the reaction times in water at four different temperatures. You'll carry out the reaction usin

A student dissolves [tex]12.6 \mathrm{~g}[/tex] of ammonium chloride [tex]\left(\mathrm{NH}_4 \mathrm{Cl}\right)[/tex] in [tex]250 . \mathrm{g}[/tex] of water i

Part E Study the trend of the graph from part C. What would the reaction time be (in seconds) if th cooled to 5°C?