woodie1735 woodie1735

24-11-2022
Chemistry

Answered

during the citric acid cycle, two co2 molecules are removed as waste. are the carbons in co2 fully oxidized or fully reduced?

Answer :

Other Questions

Name the following Acid: [tex]\mathrm{HBO}_3[/tex] if [tex]\left(\mathrm{BO}_3\right)^{-3}[/tex] is called the borate ion. borous acid hydrogen borate boric aci

Select the correct proper or common name for the compound.CCC(CCC(=O)O)C(C)Cl The compound is named: 4-ethyl-5-chlorohexanoic acid 5-chloro-4-ethylhexanoic acid

molecules at the surface of a liquid, if they possess enough kinetic energy, can escape to the gas state. as a result, a liquid will exert a vapor pressure. if

draw the major product as a planar projection (not chair conformation) for the e2 reaction shown. do not include stereochemical configurations for the chirality

Draw the best Lewis dot structure for BrCl4-. What is the geometry of the structure, (draw or name)?What types of bonds are between each atom? Is the molecule p

How many electrons are shared in the Lewis structure of CH2Cl2? Molecular structure with C atom at the center has two H atoms one in top and bottom pointing tow

The molecules CH2F2 and CH2Cl2. Both of these molecules can participate in London dispersion and dipole-dipole intermolecular forces. (2 points) If you were to

Part A In this task, you'll observe a chemical reaction between baking soda and vinegar. How do you think the temperature of the reactants and the rate of react

Which of the following statements about CH3OH and CH2O are true? The molecules of CH3OH can form London forces, dipole/dipole forces, and hydrogen bonds. The CH

Sequence Determination of the Brain Peptide Leucine Enkephalin A group of peptides that influence nerve transmission in certain parts of the brain have been iso