rouseallie8333 rouseallie8333

24-11-2022
Chemistry

Answered

when a strong acid reacts with a strong base, typically the products formed are and an ionic compound, which is called a(n) .

Answer :

Other Questions

Complete the reactions below by drawing the major product or products. Indicate product stereochemistry where appropriate. Do not draw mechanisms or minor produ

Select the correct proper or common name for the compound.CCC(CCC(=O)O)C(C)Cl The compound is named: 4-ethyl-5-chlorohexanoic acid 5-chloro-4-ethylhexanoic acid

Name the following Acid: [tex]\mathrm{HBO}_3[/tex] if [tex]\left(\mathrm{BO}_3\right)^{-3}[/tex] is called the borate ion. borous acid hydrogen borate boric aci

In the reaction of 2-chloro-2-methylpropane with [tex]\mathrm{AgNO}_3[/tex] and ethanol, one product (shown below) is formed via an [tex]\mathrm{S}_{\mathrm{n}}

draw the major product as a planar projection (not chair conformation) for the e2 reaction shown. do not include stereochemical configurations for the chirality

consider the reaction of an alkyl bromide and hydroxide ion. the alkyl bromide is a 5 carbon chain with a bromide on carbon 3 and a methyl substituent on carbon

T/F we have an rdd called data rdd that is created in python. what do you think the output of the following function will be? data rdd.countbyvalue()

draw the major organic product for the reaction shown. do not draw counterions or byproducts. draw hydrogens on oxygen and nitrogen, where appropriate. the star

Question: Given the compound, C2N2: Please show work 1. Draw the Lewis structure 2. Determine the hybridization orbitals for both C & N. 3. Determine the nu