noeliaortiz321 noeliaortiz321

24-11-2022
Chemistry

Answered

what quantity of 65 per cent acid solution must be mixed with a 20 per cent solution to produce 450 ml of a 50 per cent solution?

Answer :

Other Questions

two solutions and 19.4 kg of salt are mixed together. solution a is 5% salt and 95% water. solution b is 11% salt and 89% water. how much of solution b is added

Name the following Acid: [tex]\mathrm{HBO}_3[/tex] if [tex]\left(\mathrm{BO}_3\right)^{-3}[/tex] is called the borate ion. borous acid hydrogen borate boric aci

given that the nucleophilic substitution reaction used 5.0 ml of t-pentyl alcohol and 12.0 ml of conc. hydrochloric acid to produce t-pentyl chloride, what is t

Select the correct proper or common name for the compound.CCC(CCC(=O)O)C(C)Cl The compound is named: 4-ethyl-5-chlorohexanoic acid 5-chloro-4-ethylhexanoic acid

Carbon disulfide gas and oxygen gas react to form sulfur dioxide gas and carbon dioxide gas. What volume of sulfur dioxide would be produced by this reaction if

Each of the substances below contains structural features which would be consistent with its ability to function as a detergent. If they were to be used, which

Part F Why is it a good idea to perform three trials at each concentration? How experiment to produce more reliable results?

Sequence Determination of the Brain Peptide Leucine Enkephalin A group of peptides that influence nerve transmission in certain parts of the brain have been iso

Part F Why is it a good idea to perform three trials at each temperature? How would you modify th experiment to produce more reliable results?

Part B Next, you'll test your hypothesis by examining the reaction times of vinegar and baking s water using four different concentrations of the reactants. You