Loowkeychrissy6970 Loowkeychrissy6970

24-11-2022
Chemistry

Answered

why is it necessary to measure volumes carefeull when preparing teh acetic acid solution but not necessary to measure vbolumes too carefully when preparing the dilute naoh solution

Answer :

Other Questions

two solutions and 19.4 kg of salt are mixed together. solution a is 5% salt and 95% water. solution b is 11% salt and 89% water. how much of solution b is added

Part B Next, you'll test your hypothesis from part A by examining the reaction times in water at four different temperatures. You'll carry out the reaction usin

Name the following Acid: [tex]\mathrm{HBO}_3[/tex] if [tex]\left(\mathrm{BO}_3\right)^{-3}[/tex] is called the borate ion. borous acid hydrogen borate boric aci

Part B Next, you'll test your hypothesis by examining the reaction times of vinegar and baking s water using four different concentrations of the reactants. You

Select the correct proper or common name for the compound.CCC(CCC(=O)O)C(C)Cl The compound is named: 4-ethyl-5-chlorohexanoic acid 5-chloro-4-ethylhexanoic acid

Part F Why is it a good idea to perform three trials at each concentration? How experiment to produce more reliable results?

Part F Why is it a good idea to perform three trials at each temperature? How would you modify th experiment to produce more reliable results?

Atomic Emission Spectra When a sample of gas is excited by applying a large alternating electric field, the gas emits light at certain discrete wavelengths. The

Each of the substances below contains structural features which would be consistent with its ability to function as a detergent. If they were to be used, which