crtownsend5192 crtownsend5192

24-11-2022
Chemistry

Answered

if the enthalpy of neutralization of sodium hydroxide with hydrochloric acid is -57 kj/mol, what is your percent error? quora

Answer :

Other Questions

Which of the following reactions will provide the best yield of ether by the Williamson ether synthesis? A) Bromobenzene and sodium methoxide. B) Phenol and sod

Name the following Acid: [tex]\mathrm{HBO}_3[/tex] if [tex]\left(\mathrm{BO}_3\right)^{-3}[/tex] is called the borate ion. borous acid hydrogen borate boric aci

29.4 grams of hexacarbon hexahydride (benzene: 78.0 g/mol) is burned in 60 liters of oxygen stored at stp (1.00 atm

Select the correct proper or common name for the compound.CCC(CCC(=O)O)C(C)Cl The compound is named: 4-ethyl-5-chlorohexanoic acid 5-chloro-4-ethylhexanoic acid

The vapor pressure of 1-propanol is [tex]10.0[/tex] torr at [tex]14.7^{\circ} \mathrm{C}[/tex]. Calculate the vapor pressure at [tex]52.8^{\circ} \mathrm{C}[/te

given that the nucleophilic substitution reaction used 5.0 ml of t-pentyl alcohol and 12.0 ml of conc. hydrochloric acid to produce t-pentyl chloride, what is t

Part D Explain how the reaction rate compared to the concentration of the vinegar and bakin Revisit your hypothesis in part A, and explain how it compares with

Part D Create a presentation made up of 10-15 slides that explains the Haber proce and historical significance. In the presentation, compare the principles used

A compound containing the elements C , H , N , and O is analyzed. When a 1.2359 g sample is burned in excess oxygen, 2.241 g of CO2 (g) is formed. The combustio

Sequence Determination of the Brain Peptide Leucine Enkephalin A group of peptides that influence nerve transmission in certain parts of the brain have been iso